C10H10NO3- — CID 4573914
4-(acetamidomethyl)benzoate (PubChem CID 4573914) has the molecular formula C10H10NO3- and a molecular weight of 192.19 g/mol. Its IUPAC name is 4-(acetamidomethyl)benzoate.
| Compound Name | 4-(acetamidomethyl)benzoate |
|---|---|
| PubChem CID | 4573914 |
| Molecular Formula | C10H10NO3- |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 4-(acetamidomethyl)benzoate |
| SMILES | CC(=O)NCc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C10H11NO3/c1-7(12)11-6-8-2-4-9(5-3-8)10(13)14/h2-5H,6H2,1H3,(H,11,12)(H,13,14)/p-1 |
| InChIKey | DSEUUJNFENYHDY-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |