C14H18NO5- — CID 7335953
4-[[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]methyl]benzoate (PubChem CID 7335953) has the molecular formula C14H18NO5- and a molecular weight of 280.30 g/mol. Its IUPAC name is 4-[[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]methyl]benzoate.
| Compound Name | 4-[[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 7335953 |
| Molecular Formula | C14H18NO5- |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-[[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]methyl]benzoate |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C14H19NO5/c1-14(2,8-16)11(17)12(18)15-7-9-3-5-10(6-4-9)13(19)20/h3-6,11,16-17H,7-8H2,1-2H3,(H,15,18)(H,19,20)/p-1/t11-/m0/s1 |
| InChIKey | VUHLHICUIYPFET-NSHDSACASA-M |
| XLogP | -0.95 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |