C15H25N3O3 — CID 24835923
(2R)-N'-[[4-(dimethylamino)phenyl]methyl]-2,4-dihydroxy-3,3-dimethylbutanehydrazide (PubChem CID 24835923) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is (2R)-N'-[[4-(dimethylamino)phenyl]methyl]-2,4-dihydroxy-3,3-dimethylbutanehydrazide.
| Compound Name | (2R)-N'-[[4-(dimethylamino)phenyl]methyl]-2,4-dihydroxy-3,3-dimethylbutanehydrazide |
|---|---|
| PubChem CID | 24835923 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (2R)-N'-[[4-(dimethylamino)phenyl]methyl]-2,4-dihydroxy-3,3-dimethylbutanehydrazide |
| SMILES | CN(C)c1ccc(CNNC(=O)[C@H](O)C(C)(C)CO)cc1 |
| InChI | InChI=1S/C15H25N3O3/c1-15(2,10-19)13(20)14(21)17-16-9-11-5-7-12(8-6-11)18(3)4/h5-8,13,16,19-20H,9-10H2,1-4H3,(H,17,21)/t13-/m0/s1 |
| InChIKey | ZDVHMQAPSQDEBJ-ZDUSSCGKSA-N |
| XLogP | 0.25 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|