C20H30N4O6 — CID 123259068
N-[4-[[4-(ethylcarbamoylamino)phenyl]methylamino]-3,4-dioxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 123259068) has the molecular formula C20H30N4O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is N-[4-[[4-(ethylcarbamoylamino)phenyl]methylamino]-3,4-dioxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | N-[4-[[4-(ethylcarbamoylamino)phenyl]methylamino]-3,4-dioxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 123259068 |
| Molecular Formula | C20H30N4O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-[4-[[4-(ethylcarbamoylamino)phenyl]methylamino]-3,4-dioxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CCNC(=O)Nc1ccc(CNC(=O)C(=O)CCNC(=O)C(O)C(C)(C)CO)cc1 |
| InChI | InChI=1S/C20H30N4O6/c1-4-21-19(30)24-14-7-5-13(6-8-14)11-23-17(28)15(26)9-10-22-18(29)16(27)20(2,3)12-25/h5-8,16,25,27H,4,9-12H2,1-3H3,(H,22,29)(H,23,28)(H2,21,24,30) |
| InChIKey | YHHJEFYQKSJXMQ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 156.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|