C21H31NO7 — CID 152816433
(2R)-2,4-dihydroxy-N-[6-[4-(2-methoxyethoxy)phenyl]-3,4-dioxohexyl]-3,3-dimethylbutanamide (PubChem CID 152816433) has the molecular formula C21H31NO7 and a molecular weight of 409.48 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-N-[6-[4-(2-methoxyethoxy)phenyl]-3,4-dioxohexyl]-3,3-dimethylbutanamide.
| Compound Name | (2R)-2,4-dihydroxy-N-[6-[4-(2-methoxyethoxy)phenyl]-3,4-dioxohexyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 152816433 |
| Molecular Formula | C21H31NO7 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (2R)-2,4-dihydroxy-N-[6-[4-(2-methoxyethoxy)phenyl]-3,4-dioxohexyl]-3,3-dimethylbutanamide |
| SMILES | COCCOc1ccc(CCC(=O)C(=O)CCNC(=O)[C@H](O)C(C)(C)CO)cc1 |
| InChI | InChI=1S/C21H31NO7/c1-21(2,14-23)19(26)20(27)22-11-10-18(25)17(24)9-6-15-4-7-16(8-5-15)29-13-12-28-3/h4-5,7-8,19,23,26H,6,9-14H2,1-3H3,(H,22,27)/t19-/m0/s1 |
| InChIKey | SSLWZBNNPYTKJL-IBGZPJMESA-N |
| XLogP | 0.67 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|