C20H31N3O8S — CID 123600266
2,4-dihydroxy-N-[4-[[4-[2-(methanesulfonamido)ethoxy]phenyl]methylamino]-3,4-dioxobutyl]-3,3-dimethylbutanamide (PubChem CID 123600266) has the molecular formula C20H31N3O8S and a molecular weight of 473.55 g/mol. Its IUPAC name is 2,4-dihydroxy-N-[4-[[4-[2-(methanesulfonamido)ethoxy]phenyl]methylamino]-3,4-dioxobutyl]-3,3-dimethylbutanamide.
| Compound Name | 2,4-dihydroxy-N-[4-[[4-[2-(methanesulfonamido)ethoxy]phenyl]methylamino]-3,4-dioxobutyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 123600266 |
| Molecular Formula | C20H31N3O8S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 2,4-dihydroxy-N-[4-[[4-[2-(methanesulfonamido)ethoxy]phenyl]methylamino]-3,4-dioxobutyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)C(=O)NCc1ccc(OCCNS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H31N3O8S/c1-20(2,13-24)17(26)19(28)21-9-8-16(25)18(27)22-12-14-4-6-15(7-5-14)31-11-10-23-32(3,29)30/h4-7,17,23-24,26H,8-13H2,1-3H3,(H,21,28)(H,22,27) |
| InChIKey | QAMBCVIUSJSCGE-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 171.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|