C17H24N2O5 — CID 118272081
N-[4-(benzylamino)-3,4-dioxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 118272081) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[4-(benzylamino)-3,4-dioxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | N-[4-(benzylamino)-3,4-dioxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 118272081 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-[4-(benzylamino)-3,4-dioxobutyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O5/c1-17(2,11-20)14(22)16(24)18-9-8-13(21)15(23)19-10-12-6-4-3-5-7-12/h3-7,14,20,22H,8-11H2,1-2H3,(H,18,24)(H,19,23) |
| InChIKey | ZBYFPSMTFHUIDV-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|