C25H34N4O5 — CID 144594671
4-[[(2R)-1,4-dihydroxy-2,3,3-trimethylbutyl]amino]-2-oxo-N-[[4-(phenylcarbamoylamino)phenyl]methyl]butanamide (PubChem CID 144594671) has the molecular formula C25H34N4O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is 4-[[(2R)-1,4-dihydroxy-2,3,3-trimethylbutyl]amino]-2-oxo-N-[[4-(phenylcarbamoylamino)phenyl]methyl]butanamide.
| Compound Name | 4-[[(2R)-1,4-dihydroxy-2,3,3-trimethylbutyl]amino]-2-oxo-N-[[4-(phenylcarbamoylamino)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 144594671 |
| Molecular Formula | C25H34N4O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 4-[[(2R)-1,4-dihydroxy-2,3,3-trimethylbutyl]amino]-2-oxo-N-[[4-(phenylcarbamoylamino)phenyl]methyl]butanamide |
| SMILES | C[C@@H](C(O)NCCC(=O)C(=O)NCc1ccc(NC(=O)Nc2ccccc2)cc1)C(C)(C)CO |
| InChI | InChI=1S/C25H34N4O5/c1-17(25(2,3)16-30)22(32)26-14-13-21(31)23(33)27-15-18-9-11-20(12-10-18)29-24(34)28-19-7-5-4-6-8-19/h4-12,17,22,26,30,32H,13-16H2,1-3H3,(H,27,33)(H2,28,29,34)/t17-,22?/m0/s1 |
| InChIKey | RXCSBYICUIZQES-LBOXEOMUSA-N |
| XLogP | 2.47 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|