C22H32N2O6 — CID 159197025
(2R)-N-[6-[4-(butanoylamino)phenyl]-3,4-dioxohexyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 159197025) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is (2R)-N-[6-[4-(butanoylamino)phenyl]-3,4-dioxohexyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | (2R)-N-[6-[4-(butanoylamino)phenyl]-3,4-dioxohexyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 159197025 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (2R)-N-[6-[4-(butanoylamino)phenyl]-3,4-dioxohexyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CCCC(=O)Nc1ccc(CCC(=O)C(=O)CCNC(=O)[C@H](O)C(C)(C)CO)cc1 |
| InChI | InChI=1S/C22H32N2O6/c1-4-5-19(28)24-16-9-6-15(7-10-16)8-11-17(26)18(27)12-13-23-21(30)20(29)22(2,3)14-25/h6-7,9-10,20,25,29H,4-5,8,11-14H2,1-3H3,(H,23,30)(H,24,28)/t20-/m0/s1 |
| InChIKey | WITMMSBOWRANES-FQEVSTJZSA-N |
| XLogP | 1.38 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|