C24H40N2O3 — CID 162755789
tert-butyl N-[3-(4-decylanilino)-3-oxopropyl]carbamate (PubChem CID 162755789) has the molecular formula C24H40N2O3 and a molecular weight of 404.60 g/mol. Its IUPAC name is tert-butyl N-[3-(4-decylanilino)-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-decylanilino)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 162755789 |
| Molecular Formula | C24H40N2O3 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | tert-butyl N-[3-(4-decylanilino)-3-oxopropyl]carbamate |
| SMILES | CCCCCCCCCCc1ccc(NC(=O)CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H40N2O3/c1-5-6-7-8-9-10-11-12-13-20-14-16-21(17-15-20)26-22(27)18-19-25-23(28)29-24(2,3)4/h14-17H,5-13,18-19H2,1-4H3,(H,25,28)(H,26,27) |
| InChIKey | CRXNGRDCDGUXMC-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|