C33H55N3O5 — CID 67795725
(Z)-N-[3-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]phenyl]octadec-9-enamide (PubChem CID 67795725) has the molecular formula C33H55N3O5 and a molecular weight of 573.82 g/mol. Its IUPAC name is (Z)-N-[3-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]phenyl]octadec-9-enamide.
| Compound Name | (Z)-N-[3-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]phenyl]octadec-9-enamide |
|---|---|
| PubChem CID | 67795725 |
| Molecular Formula | C33H55N3O5 |
| Molecular Weight | 573.82 g/mol |
| Exact Mass | 573.41 |
| IUPAC Name | (Z)-N-[3-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]phenyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Nc1cccc(NC(=O)CCNC(=O)C(O)C(C)(C)CO)c1 |
| InChI | InChI=1S/C33H55N3O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-29(38)35-27-20-19-21-28(25-27)36-30(39)23-24-34-32(41)31(40)33(2,3)26-37/h11-12,19-21,25,31,37,40H,4-10,13-18,22-24,26H2,1-3H3,(H,34,41)(H,35,38)(H,36,39)/b12-11- |
| InChIKey | USOSYXMZIQJCBD-QXMHVHEDSA-N |
| XLogP | 6.49 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.82 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|