C32H60N4O5 — CID 19893680
(E)-N-[3-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]piperidin-1-yl]octadec-9-enamide (PubChem CID 19893680) has the molecular formula C32H60N4O5 and a molecular weight of 580.86 g/mol. Its IUPAC name is (E)-N-[3-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]piperidin-1-yl]octadec-9-enamide.
| Compound Name | (E)-N-[3-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]piperidin-1-yl]octadec-9-enamide |
|---|---|
| PubChem CID | 19893680 |
| Molecular Formula | C32H60N4O5 |
| Molecular Weight | 580.86 g/mol |
| Exact Mass | 580.46 |
| IUPAC Name | (E)-N-[3-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]piperidin-1-yl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)NN1CCCC(NC(=O)CCNC(=O)C(O)C(C)(C)CO)C1 |
| InChI | InChI=1S/C32H60N4O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-29(39)35-36-24-19-20-27(25-36)34-28(38)22-23-33-31(41)30(40)32(2,3)26-37/h11-12,27,30,37,40H,4-10,13-26H2,1-3H3,(H,33,41)(H,34,38)(H,35,39)/b12-11+ |
| InChIKey | ALDGVKZZFQYMCG-VAWYXSNFSA-N |
| XLogP | 4.52 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.86 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|