C32H59N3O6 — CID 67795557
[(2S)-1-octadec-9-enoylpyrrolidin-2-yl]methyl 3-[2-(2,4-dihydroxy-3,3-dimethylbutanoyl)hydrazinyl]propanoate (PubChem CID 67795557) has the molecular formula C32H59N3O6 and a molecular weight of 581.84 g/mol. Its IUPAC name is [(2S)-1-octadec-9-enoylpyrrolidin-2-yl]methyl 3-[2-(2,4-dihydroxy-3,3-dimethylbutanoyl)hydrazinyl]propanoate.
| Compound Name | [(2S)-1-octadec-9-enoylpyrrolidin-2-yl]methyl 3-[2-(2,4-dihydroxy-3,3-dimethylbutanoyl)hydrazinyl]propanoate |
|---|---|
| PubChem CID | 67795557 |
| Molecular Formula | C32H59N3O6 |
| Molecular Weight | 581.84 g/mol |
| Exact Mass | 581.44 |
| IUPAC Name | [(2S)-1-octadec-9-enoylpyrrolidin-2-yl]methyl 3-[2-(2,4-dihydroxy-3,3-dimethylbutanoyl)hydrazinyl]propanoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N1CCC[C@H]1COC(=O)CCNNC(=O)C(O)C(C)(C)CO |
| InChI | InChI=1S/C32H59N3O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-28(37)35-24-19-20-27(35)25-41-29(38)22-23-33-34-31(40)30(39)32(2,3)26-36/h11-12,27,30,33,36,39H,4-10,13-26H2,1-3H3,(H,34,40)/t27-,30?/m0/s1 |
| InChIKey | MYKOUJJDCNAIIZ-CEBUJLNPSA-N |
| XLogP | 4.95 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.84 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|