C36H62N2O8 — CID 67795052
[(2S)-1-octadec-9-enoylpyrrolidin-2-yl]methyl 3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]propanoate (PubChem CID 67795052) has the molecular formula C36H62N2O8 and a molecular weight of 650.90 g/mol. Its IUPAC name is [(2S)-1-octadec-9-enoylpyrrolidin-2-yl]methyl 3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]propanoate.
| Compound Name | [(2S)-1-octadec-9-enoylpyrrolidin-2-yl]methyl 3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]propanoate |
|---|---|
| PubChem CID | 67795052 |
| Molecular Formula | C36H62N2O8 |
| Molecular Weight | 650.90 g/mol |
| Exact Mass | 650.45 |
| IUPAC Name | [(2S)-1-octadec-9-enoylpyrrolidin-2-yl]methyl 3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]propanoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N1CCC[C@H]1COC(=O)CCNC(=O)C(OC(C)=O)C(C)(C)COC(C)=O |
| InChI | InChI=1S/C36H62N2O8/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-32(41)38-26-21-22-31(38)27-44-33(42)24-25-37-35(43)34(46-30(3)40)36(4,5)28-45-29(2)39/h13-14,31,34H,6-12,15-28H2,1-5H3,(H,37,43)/t31-,34?/m0/s1 |
| InChIKey | SKEOCWLCLLCIIK-PTYUOYDSSA-N |
| XLogP | 6.59 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.90 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|