C37H58N2O8 — CID 54101696
[4-[3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]propanoylamino]phenyl] octadec-9-enoate (PubChem CID 54101696) has the molecular formula C37H58N2O8 and a molecular weight of 658.88 g/mol. Its IUPAC name is [4-[3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]propanoylamino]phenyl] octadec-9-enoate.
| Compound Name | [4-[3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]propanoylamino]phenyl] octadec-9-enoate |
|---|---|
| PubChem CID | 54101696 |
| Molecular Formula | C37H58N2O8 |
| Molecular Weight | 658.88 g/mol |
| Exact Mass | 658.42 |
| IUPAC Name | [4-[3-[(2,4-diacetyloxy-3,3-dimethylbutanoyl)amino]propanoylamino]phenyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)Oc1ccc(NC(=O)CCNC(=O)C(OC(C)=O)C(C)(C)COC(C)=O)cc1 |
| InChI | InChI=1S/C37H58N2O8/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-34(43)47-32-24-22-31(23-25-32)39-33(42)26-27-38-36(44)35(46-30(3)41)37(4,5)28-45-29(2)40/h13-14,22-25,35H,6-12,15-21,26-28H2,1-5H3,(H,38,44)(H,39,42) |
| InChIKey | NAXUSMKVDKJOON-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.88 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|