C15H26N2O6S — CID 156904721
[(3R)-3-acetyloxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] acetate (PubChem CID 156904721) has the molecular formula C15H26N2O6S and a molecular weight of 362.45 g/mol. Its IUPAC name is [(3R)-3-acetyloxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] acetate.
| Compound Name | [(3R)-3-acetyloxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] acetate |
|---|---|
| PubChem CID | 156904721 |
| Molecular Formula | C15H26N2O6S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [(3R)-3-acetyloxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] acetate |
| SMILES | CC(=O)OCC(C)(C)[C@@H](OC(C)=O)C(=O)NCCC(=O)NCCS |
| InChI | InChI=1S/C15H26N2O6S/c1-10(18)22-9-15(3,4)13(23-11(2)19)14(21)17-6-5-12(20)16-7-8-24/h13,24H,5-9H2,1-4H3,(H,16,20)(H,17,21)/t13-/m0/s1 |
| InChIKey | BZMADVAUGRPAMB-ZDUSSCGKSA-N |
| XLogP | 0.06 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|