C17H38N2O4S — CID 144631598
ethane;(2R)-2-hydroxy-4-methoxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;propane (PubChem CID 144631598) has the molecular formula C17H38N2O4S and a molecular weight of 366.57 g/mol. Its IUPAC name is ethane;(2R)-2-hydroxy-4-methoxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;propane.
| Compound Name | ethane;(2R)-2-hydroxy-4-methoxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;propane |
|---|---|
| PubChem CID | 144631598 |
| Molecular Formula | C17H38N2O4S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | ethane;(2R)-2-hydroxy-4-methoxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;propane |
| SMILES | CC.CCC.COCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCS |
| InChI | InChI=1S/C12H24N2O4S.C3H8.C2H6/c1-12(2,8-18-3)10(16)11(17)14-5-4-9(15)13-6-7-19;1-3-2;1-2/h10,16,19H,4-8H2,1-3H3,(H,13,15)(H,14,17);3H2,1-2H3;1-2H3/t10-;;/m0../s1 |
| InChIKey | GFADYLAWXJBAHE-XRIOVQLTSA-N |
| XLogP | 2.01 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|