C19H39N2O7PS — CID 89127876
dibutyl [(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] phosphate (PubChem CID 89127876) has the molecular formula C19H39N2O7PS and a molecular weight of 470.57 g/mol. Its IUPAC name is dibutyl [(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] phosphate.
| Compound Name | dibutyl [(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] phosphate |
|---|---|
| PubChem CID | 89127876 |
| Molecular Formula | C19H39N2O7PS |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | dibutyl [(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-[[3-oxo-3-(2-sulfanylethylamino)propyl]amino]butyl] phosphate |
| SMILES | CCCCOP(=O)(OCCCC)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCS |
| InChI | InChI=1S/C19H39N2O7PS/c1-5-7-12-26-29(25,27-13-8-6-2)28-15-19(3,4)17(23)18(24)21-10-9-16(22)20-11-14-30/h17,23,30H,5-15H2,1-4H3,(H,20,22)(H,21,24)/t17-/m0/s1 |
| InChIKey | ANSGENDJFHIFJM-KRWDZBQOSA-N |
| XLogP | 2.68 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|