C11H25N2O8PS — CID 87535757
2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;phosphoric acid (PubChem CID 87535757) has the molecular formula C11H25N2O8PS and a molecular weight of 376.37 g/mol. Its IUPAC name is 2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;phosphoric acid.
| Compound Name | 2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;phosphoric acid |
|---|---|
| PubChem CID | 87535757 |
| Molecular Formula | C11H25N2O8PS |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;phosphoric acid |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)NCCS.O=P(O)(O)O |
| InChI | InChI=1S/C11H22N2O4S.H3O4P/c1-11(2,7-14)9(16)10(17)13-4-3-8(15)12-5-6-18;1-5(2,3)4/h9,14,16,18H,3-7H2,1-2H3,(H,12,15)(H,13,17);(H3,1,2,3,4) |
| InChIKey | OQSWKOQXIQBNHB-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 176.42 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|