C10H21N3O4 — CID 145046694
N-[3-(aminomethylamino)-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 145046694) has the molecular formula C10H21N3O4 and a molecular weight of 247.29 g/mol. Its IUPAC name is N-[3-(aminomethylamino)-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | N-[3-(aminomethylamino)-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 145046694 |
| Molecular Formula | C10H21N3O4 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | N-[3-(aminomethylamino)-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)NCN |
| InChI | InChI=1S/C10H21N3O4/c1-10(2,5-14)8(16)9(17)12-4-3-7(15)13-6-11/h8,14,16H,3-6,11H2,1-2H3,(H,12,17)(H,13,15) |
| InChIKey | GUZJLOUKOSZDTI-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|