C18H34CaN2O10 — CID 172837539
CID 172837539 (PubChem CID 172837539) has the molecular formula C18H34CaN2O10 and a molecular weight of 478.55 g/mol.
| Compound Name | CID 172837539 |
|---|---|
| PubChem CID | 172837539 |
| Molecular Formula | C18H34CaN2O10 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | — |
| SMILES | CC(C)(CO)[C@H](O)C(=O)NCCC(=O)O.CC(C)(CO)[C@H](O)C(=O)NCCC(=O)O.[Ca] |
| InChI | InChI=1S/2C9H17NO5.Ca/c2*1-9(2,5-11)7(14)8(15)10-4-3-6(12)13;/h2*7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13);/t2*7-;/m11./s1 |
| InChIKey | WIWQIMNDNVAWQN-CTWWJBIBSA-N |
| XLogP | -2.47 |
| TPSA | 213.72 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |