C9H20NO5P — CID 174763260
3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid;phosphane (PubChem CID 174763260) has the molecular formula C9H20NO5P and a molecular weight of 253.23 g/mol. Its IUPAC name is 3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid;phosphane.
| Compound Name | 3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid;phosphane |
|---|---|
| PubChem CID | 174763260 |
| Molecular Formula | C9H20NO5P |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoic acid;phosphane |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)O.P |
| InChI | InChI=1S/C9H17NO5.H3P/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13;/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13);1H3 |
| InChIKey | RQTOKNYQEDLHQH-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|