C11H26N2O4S3 — CID 130431622
2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;sulfane (PubChem CID 130431622) has the molecular formula C11H26N2O4S3 and a molecular weight of 346.54 g/mol. Its IUPAC name is 2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;sulfane.
| Compound Name | 2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;sulfane |
|---|---|
| PubChem CID | 130431622 |
| Molecular Formula | C11H26N2O4S3 |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(2-sulfanylethylamino)propyl]butanamide;sulfane |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)NCCS.S.S |
| InChI | InChI=1S/C11H22N2O4S.2H2S/c1-11(2,7-14)9(16)10(17)13-4-3-8(15)12-5-6-18;;/h9,14,16,18H,3-7H2,1-2H3,(H,12,15)(H,13,17);2*1H2 |
| InChIKey | AILPTIKUTGUIRT-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|