C14H29N3O4 — CID 90682464
(2R)-N-[3-[3-(dimethylamino)propylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 90682464) has the molecular formula C14H29N3O4 and a molecular weight of 303.40 g/mol. Its IUPAC name is (2R)-N-[3-[3-(dimethylamino)propylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | (2R)-N-[3-[3-(dimethylamino)propylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 90682464 |
| Molecular Formula | C14H29N3O4 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (2R)-N-[3-[3-(dimethylamino)propylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CN(C)CCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C14H29N3O4/c1-14(2,10-18)12(20)13(21)16-8-6-11(19)15-7-5-9-17(3)4/h12,18,20H,5-10H2,1-4H3,(H,15,19)(H,16,21)/t12-/m0/s1 |
| InChIKey | VZHKAUVELJZXAL-LBPRGKRZSA-N |
| XLogP | -1.06 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|