C14H26N2O5S — CID 146597968
S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] propanethioate (PubChem CID 146597968) has the molecular formula C14H26N2O5S and a molecular weight of 334.44 g/mol. Its IUPAC name is S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] propanethioate.
| Compound Name | S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] propanethioate |
|---|---|
| PubChem CID | 146597968 |
| Molecular Formula | C14H26N2O5S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] propanethioate |
| SMILES | CCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C14H26N2O5S/c1-4-11(19)22-8-7-15-10(18)5-6-16-13(21)12(20)14(2,3)9-17/h12,17,20H,4-9H2,1-3H3,(H,15,18)(H,16,21)/t12-/m0/s1 |
| InChIKey | JDNYVZBVEBRRCT-LBPRGKRZSA-N |
| XLogP | -0.34 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|