C25H46N2O7S2 — CID 164984950
(2R)-N-[3-[2-[[(9R)-9,11-dihydroxy-10,10-dimethyl-4,8-dioxoundecyl]disulfanyl]ethylamino]-3-oxopropyl]-2-hydroxy-3,3-dimethylpentanamide (PubChem CID 164984950) has the molecular formula C25H46N2O7S2 and a molecular weight of 550.78 g/mol. Its IUPAC name is (2R)-N-[3-[2-[[(9R)-9,11-dihydroxy-10,10-dimethyl-4,8-dioxoundecyl]disulfanyl]ethylamino]-3-oxopropyl]-2-hydroxy-3,3-dimethylpentanamide.
| Compound Name | (2R)-N-[3-[2-[[(9R)-9,11-dihydroxy-10,10-dimethyl-4,8-dioxoundecyl]disulfanyl]ethylamino]-3-oxopropyl]-2-hydroxy-3,3-dimethylpentanamide |
|---|---|
| PubChem CID | 164984950 |
| Molecular Formula | C25H46N2O7S2 |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | (2R)-N-[3-[2-[[(9R)-9,11-dihydroxy-10,10-dimethyl-4,8-dioxoundecyl]disulfanyl]ethylamino]-3-oxopropyl]-2-hydroxy-3,3-dimethylpentanamide |
| SMILES | CCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCSSCCCC(=O)CCCC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C25H46N2O7S2/c1-6-24(2,3)22(33)23(34)27-13-12-20(31)26-14-16-36-35-15-8-10-18(29)9-7-11-19(30)21(32)25(4,5)17-28/h21-22,28,32-33H,6-17H2,1-5H3,(H,26,31)(H,27,34)/t21-,22-/m0/s1 |
| InChIKey | GAFKUZHJCGRQFW-VXKWHMMOSA-N |
| XLogP | 2.26 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|