C14H24N2O6S — CID 177478478
S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 2-oxopropanethioate (PubChem CID 177478478) has the molecular formula C14H24N2O6S and a molecular weight of 348.42 g/mol. Its IUPAC name is S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 2-oxopropanethioate.
| Compound Name | S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 2-oxopropanethioate |
|---|---|
| PubChem CID | 177478478 |
| Molecular Formula | C14H24N2O6S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 2-oxopropanethioate |
| SMILES | CC(=O)C(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C14H24N2O6S/c1-9(18)13(22)23-7-6-15-10(19)4-5-16-12(21)11(20)14(2,3)8-17/h11,17,20H,4-8H2,1-3H3,(H,15,19)(H,16,21)/t11-/m0/s1 |
| InChIKey | CAHSVVXJKPBASO-NSHDSACASA-N |
| XLogP | -1.16 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|