C18H32N2O6S — CID 162512941
S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 4-methyl-3-oxohexanethioate (PubChem CID 162512941) has the molecular formula C18H32N2O6S and a molecular weight of 404.53 g/mol. Its IUPAC name is S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 4-methyl-3-oxohexanethioate.
| Compound Name | S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 4-methyl-3-oxohexanethioate |
|---|---|
| PubChem CID | 162512941 |
| Molecular Formula | C18H32N2O6S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 4-methyl-3-oxohexanethioate |
| SMILES | CCC(C)C(=O)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C18H32N2O6S/c1-5-12(2)13(22)10-15(24)27-9-8-19-14(23)6-7-20-17(26)16(25)18(3,4)11-21/h12,16,21,25H,5-11H2,1-4H3,(H,19,23)(H,20,26)/t12?,16-/m0/s1 |
| InChIKey | BYKPVBAUDLVBDH-INSVYWFGSA-N |
| XLogP | 0.25 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|