C24H42N2O5S — CID 10412451
S-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyl] trideca-3,4-dienethioate (PubChem CID 10412451) has the molecular formula C24H42N2O5S and a molecular weight of 470.68 g/mol. Its IUPAC name is S-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyl] trideca-3,4-dienethioate.
| Compound Name | S-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyl] trideca-3,4-dienethioate |
|---|---|
| PubChem CID | 10412451 |
| Molecular Formula | C24H42N2O5S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | S-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyl] trideca-3,4-dienethioate |
| SMILES | CCCCCCCCC=C=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO |
| InChI | InChI=1S/C24H42N2O5S/c1-4-5-6-7-8-9-10-11-12-13-14-21(29)32-18-17-25-20(28)15-16-26-23(31)22(30)24(2,3)19-27/h11,13,22,27,30H,4-10,14-19H2,1-3H3,(H,25,28)(H,26,31) |
| InChIKey | KCKFAFAPPVEIIB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|