C13H23ClN2O5S — CID 11314233
S-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyl] 2-chloroethanethioate (PubChem CID 11314233) has the molecular formula C13H23ClN2O5S and a molecular weight of 354.86 g/mol. Its IUPAC name is S-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyl] 2-chloroethanethioate.
| Compound Name | S-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyl] 2-chloroethanethioate |
|---|---|
| PubChem CID | 11314233 |
| Molecular Formula | C13H23ClN2O5S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | S-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyl] 2-chloroethanethioate |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)NCCSC(=O)CCl |
| InChI | InChI=1S/C13H23ClN2O5S/c1-13(2,8-17)11(20)12(21)16-4-3-9(18)15-5-6-22-10(19)7-14/h11,17,20H,3-8H2,1-2H3,(H,15,18)(H,16,21) |
| InChIKey | OETZLUOOKADLAA-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|