C15H30N2O5 — CID 25172212
(2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(3-propan-2-yloxypropylamino)propyl]butanamide (PubChem CID 25172212) has the molecular formula C15H30N2O5 and a molecular weight of 318.41 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(3-propan-2-yloxypropylamino)propyl]butanamide.
| Compound Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(3-propan-2-yloxypropylamino)propyl]butanamide |
|---|---|
| PubChem CID | 25172212 |
| Molecular Formula | C15H30N2O5 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2R)-2,4-dihydroxy-3,3-dimethyl-N-[3-oxo-3-(3-propan-2-yloxypropylamino)propyl]butanamide |
| SMILES | CC(C)OCCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C15H30N2O5/c1-11(2)22-9-5-7-16-12(19)6-8-17-14(21)13(20)15(3,4)10-18/h11,13,18,20H,5-10H2,1-4H3,(H,16,19)(H,17,21)/t13-/m0/s1 |
| InChIKey | JQYCGAUFYWTFLH-ZDUSSCGKSA-N |
| XLogP | -0.20 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|