C21H41N3O6 — CID 25170540
tert-butyl N-[6-[4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]butanoylamino]hexyl]carbamate (PubChem CID 25170540) has the molecular formula C21H41N3O6 and a molecular weight of 431.57 g/mol. Its IUPAC name is tert-butyl N-[6-[4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]butanoylamino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]butanoylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 25170540 |
| Molecular Formula | C21H41N3O6 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | tert-butyl N-[6-[4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]butanoylamino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNC(=O)CCCNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C21H41N3O6/c1-20(2,3)30-19(29)24-13-9-7-6-8-12-22-16(26)11-10-14-23-18(28)17(27)21(4,5)15-25/h17,25,27H,6-15H2,1-5H3,(H,22,26)(H,23,28)(H,24,29)/t17-/m0/s1 |
| InChIKey | IUKFYDNOIUXVGW-KRWDZBQOSA-N |
| XLogP | 1.46 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|