C13H26N2O5 — CID 121329384
(2R)-N-[2-(3-ethoxypropanoylamino)ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 121329384) has the molecular formula C13H26N2O5 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2R)-N-[2-(3-ethoxypropanoylamino)ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | (2R)-N-[2-(3-ethoxypropanoylamino)ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 121329384 |
| Molecular Formula | C13H26N2O5 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (2R)-N-[2-(3-ethoxypropanoylamino)ethyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CCOCCC(=O)NCCNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C13H26N2O5/c1-4-20-8-5-10(17)14-6-7-15-12(19)11(18)13(2,3)9-16/h11,16,18H,4-9H2,1-3H3,(H,14,17)(H,15,19)/t11-/m0/s1 |
| InChIKey | MEDGKYIMEBXSRL-NSHDSACASA-N |
| XLogP | -0.98 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|