C13H29NO5 — CID 87265025
2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide;ethoxyethane (PubChem CID 87265025) has the molecular formula C13H29NO5 and a molecular weight of 279.38 g/mol. Its IUPAC name is 2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide;ethoxyethane.
| Compound Name | 2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide;ethoxyethane |
|---|---|
| PubChem CID | 87265025 |
| Molecular Formula | C13H29NO5 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide;ethoxyethane |
| SMILES | CC(C)(CO)C(O)C(=O)NCCCO.CCOCC |
| InChI | InChI=1S/C9H19NO4.C4H10O/c1-9(2,6-12)7(13)8(14)10-4-3-5-11;1-3-5-4-2/h7,11-13H,3-6H2,1-2H3,(H,10,14);3-4H2,1-2H3 |
| InChIKey | IBZXWONKCKEVNM-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|