C31H51NO6 — CID 129185008
(2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide;(2E,4E,6E,8E,10E,12E)-docosa-2,4,6,8,10,12-hexaenoic acid (PubChem CID 129185008) has the molecular formula C31H51NO6 and a molecular weight of 533.75 g/mol. Its IUPAC name is (2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide;(2E,4E,6E,8E,10E,12E)-docosa-2,4,6,8,10,12-hexaenoic acid.
| Compound Name | (2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide;(2E,4E,6E,8E,10E,12E)-docosa-2,4,6,8,10,12-hexaenoic acid |
|---|---|
| PubChem CID | 129185008 |
| Molecular Formula | C31H51NO6 |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.37 |
| IUPAC Name | (2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide;(2E,4E,6E,8E,10E,12E)-docosa-2,4,6,8,10,12-hexaenoic acid |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCCO.CCCCCCCCC/C=C/C=C/C=C/C=C/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C22H32O2.C9H19NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-9(2,6-12)7(13)8(14)10-4-3-5-11/h10-21H,2-9H2,1H3,(H,23,24);7,11-13H,3-6H2,1-2H3,(H,10,14)/b11-10+,13-12+,15-14+,17-16+,19-18+,21-20+;/t;7-/m.0/s1 |
| InChIKey | BVGSYCRAIHMZTI-ZIKHSMHRSA-N |
| XLogP | 5.41 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|