C11H25NO4Si — CID 154344563
(2R)-N-(3-dimethylsilyl-3-hydroxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 154344563) has the molecular formula C11H25NO4Si and a molecular weight of 263.41 g/mol. Its IUPAC name is (2R)-N-(3-dimethylsilyl-3-hydroxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | (2R)-N-(3-dimethylsilyl-3-hydroxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 154344563 |
| Molecular Formula | C11H25NO4Si |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (2R)-N-(3-dimethylsilyl-3-hydroxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | C[SiH](C)C(O)CCNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C11H25NO4Si/c1-11(2,7-13)9(15)10(16)12-6-5-8(14)17(3)4/h8-9,13-15,17H,5-7H2,1-4H3,(H,12,16)/t8?,9-/m0/s1 |
| InChIKey | YROMILUPTXPHPW-GKAPJAKFSA-N |
| XLogP | -0.74 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|