C8H16NO6S- — CID 74652428
2-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]ethanesulfonate (PubChem CID 74652428) has the molecular formula C8H16NO6S- and a molecular weight of 254.28 g/mol. Its IUPAC name is 2-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]ethanesulfonate.
| Compound Name | 2-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]ethanesulfonate |
|---|---|
| PubChem CID | 74652428 |
| Molecular Formula | C8H16NO6S- |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]ethanesulfonate |
| SMILES | CC(C)(CO)C(O)C(=O)NCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H17NO6S/c1-8(2,5-10)6(11)7(12)9-3-4-16(13,14)15/h6,10-11H,3-5H2,1-2H3,(H,9,12)(H,13,14,15)/p-1 |
| InChIKey | IZRUXXTXKZAGQQ-UHFFFAOYSA-M |
| XLogP | -1.97 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|