C9H19NO5 — CID 142091533
N-(3,3-dihydroxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 142091533) has the molecular formula C9H19NO5 and a molecular weight of 221.25 g/mol. Its IUPAC name is N-(3,3-dihydroxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | N-(3,3-dihydroxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 142091533 |
| Molecular Formula | C9H19NO5 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | N-(3,3-dihydroxypropyl)-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(O)O |
| InChI | InChI=1S/C9H19NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h6-7,11-14H,3-5H2,1-2H3,(H,10,15) |
| InChIKey | GNBVQRALASYINB-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|