C13H25NO4 — CID 54227933
N-(3-ethyl-4-oxopentyl)-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 54227933) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(3-ethyl-4-oxopentyl)-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | N-(3-ethyl-4-oxopentyl)-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 54227933 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | N-(3-ethyl-4-oxopentyl)-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CCC(CCNC(=O)C(O)C(C)(C)CO)C(C)=O |
| InChI | InChI=1S/C13H25NO4/c1-5-10(9(2)16)6-7-14-12(18)11(17)13(3,4)8-15/h10-11,15,17H,5-8H2,1-4H3,(H,14,18) |
| InChIKey | WAUNCFLRXTUEOH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |