C17H28N2O5S — CID 164888875
S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] hex-2-ynethioate (PubChem CID 164888875) has the molecular formula C17H28N2O5S and a molecular weight of 372.49 g/mol. Its IUPAC name is S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] hex-2-ynethioate.
| Compound Name | S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] hex-2-ynethioate |
|---|---|
| PubChem CID | 164888875 |
| Molecular Formula | C17H28N2O5S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | S-[2-[3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] hex-2-ynethioate |
| SMILES | CCCC#CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO |
| InChI | InChI=1S/C17H28N2O5S/c1-4-5-6-7-14(22)25-11-10-18-13(21)8-9-19-16(24)15(23)17(2,3)12-20/h15,20,23H,4-5,8-12H2,1-3H3,(H,18,21)(H,19,24)/t15-/m0/s1 |
| InChIKey | RKEVZSKMPWBSJP-HNNXBMFYSA-N |
| XLogP | 0.05 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|