C19H33NO4S — CID 101110014
S-[2-(octanoylamino)ethyl] (6S,8S)-6,8-dihydroxynon-2-ynethioate (PubChem CID 101110014) has the molecular formula C19H33NO4S and a molecular weight of 371.54 g/mol. Its IUPAC name is S-[2-(octanoylamino)ethyl] (6S,8S)-6,8-dihydroxynon-2-ynethioate.
| Compound Name | S-[2-(octanoylamino)ethyl] (6S,8S)-6,8-dihydroxynon-2-ynethioate |
|---|---|
| PubChem CID | 101110014 |
| Molecular Formula | C19H33NO4S |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | S-[2-(octanoylamino)ethyl] (6S,8S)-6,8-dihydroxynon-2-ynethioate |
| SMILES | CCCCCCCC(=O)NCCSC(=O)C#CCC[C@H](O)C[C@H](C)O |
| InChI | InChI=1S/C19H33NO4S/c1-3-4-5-6-7-11-18(23)20-13-14-25-19(24)12-9-8-10-17(22)15-16(2)21/h16-17,21-22H,3-8,10-11,13-15H2,1-2H3,(H,20,23)/t16-,17-/m0/s1 |
| InChIKey | ZOIJGWRKDXDTEN-IRXDYDNUSA-N |
| XLogP | 2.64 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|