C22H41NO4S — CID 101110011
S-[2-(octanoylamino)ethyl] (E,6S,8R)-6,8-dihydroxy-2,9-dimethyldec-2-enethioate (PubChem CID 101110011) has the molecular formula C22H41NO4S and a molecular weight of 415.64 g/mol. Its IUPAC name is S-[2-(octanoylamino)ethyl] (E,6S,8R)-6,8-dihydroxy-2,9-dimethyldec-2-enethioate.
| Compound Name | S-[2-(octanoylamino)ethyl] (E,6S,8R)-6,8-dihydroxy-2,9-dimethyldec-2-enethioate |
|---|---|
| PubChem CID | 101110011 |
| Molecular Formula | C22H41NO4S |
| Molecular Weight | 415.64 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | S-[2-(octanoylamino)ethyl] (E,6S,8R)-6,8-dihydroxy-2,9-dimethyldec-2-enethioate |
| SMILES | CCCCCCCC(=O)NCCSC(=O)/C(C)=C/CC[C@H](O)C[C@@H](O)C(C)C |
| InChI | InChI=1S/C22H41NO4S/c1-5-6-7-8-9-13-21(26)23-14-15-28-22(27)18(4)11-10-12-19(24)16-20(25)17(2)3/h11,17,19-20,24-25H,5-10,12-16H2,1-4H3,(H,23,26)/b18-11+/t19-,20+/m0/s1 |
| InChIKey | WGBGWJMFQFQNEU-FPZBBQJASA-N |
| XLogP | 4.22 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|