C18H26N2O5S — CID 87127654
S-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyl] benzenecarbothioate (PubChem CID 87127654) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is S-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyl] benzenecarbothioate.
| Compound Name | S-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyl] benzenecarbothioate |
|---|---|
| PubChem CID | 87127654 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | S-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyl] benzenecarbothioate |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)NCCSC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O5S/c1-18(2,12-21)15(23)16(24)20-9-8-14(22)19-10-11-26-17(25)13-6-4-3-5-7-13/h3-7,15,21,23H,8-12H2,1-2H3,(H,19,22)(H,20,24) |
| InChIKey | UJKWVVLRVCSFBB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|