C19H25N3O6S — CID 118958949
N-[3-[2-(1,3-dioxoisoindol-2-yl)sulfanylethylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 118958949) has the molecular formula C19H25N3O6S and a molecular weight of 423.49 g/mol. Its IUPAC name is N-[3-[2-(1,3-dioxoisoindol-2-yl)sulfanylethylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | N-[3-[2-(1,3-dioxoisoindol-2-yl)sulfanylethylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 118958949 |
| Molecular Formula | C19H25N3O6S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-[3-[2-(1,3-dioxoisoindol-2-yl)sulfanylethylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)NCCSN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H25N3O6S/c1-19(2,11-23)15(25)16(26)21-8-7-14(24)20-9-10-29-22-17(27)12-5-3-4-6-13(12)18(22)28/h3-6,15,23,25H,7-11H2,1-2H3,(H,20,24)(H,21,26) |
| InChIKey | MPNILDMEWFTJQS-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|