C12H12N2O3S — CID 555050
N-[2-(1,3-dioxoisoindol-2-yl)sulfanylethyl]acetamide (PubChem CID 555050) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is N-[2-(1,3-dioxoisoindol-2-yl)sulfanylethyl]acetamide.
| Compound Name | N-[2-(1,3-dioxoisoindol-2-yl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 555050 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | N-[2-(1,3-dioxoisoindol-2-yl)sulfanylethyl]acetamide |
| SMILES | CC(=O)NCCSN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H12N2O3S/c1-8(15)13-6-7-18-14-11(16)9-4-2-3-5-10(9)12(14)17/h2-5H,6-7H2,1H3,(H,13,15) |
| InChIKey | XZJJFDJSAXIMAP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|