C12H10ClNO4S — CID 88805721
2-(1,3-dioxoisoindol-2-yl)sulfanylethyl 2-chloroacetate (PubChem CID 88805721) has the molecular formula C12H10ClNO4S and a molecular weight of 299.74 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)sulfanylethyl 2-chloroacetate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)sulfanylethyl 2-chloroacetate |
|---|---|
| PubChem CID | 88805721 |
| Molecular Formula | C12H10ClNO4S |
| Molecular Weight | 299.74 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)sulfanylethyl 2-chloroacetate |
| SMILES | O=C(CCl)OCCSN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H10ClNO4S/c13-7-10(15)18-5-6-19-14-11(16)8-3-1-2-4-9(8)12(14)17/h1-4H,5-7H2 |
| InChIKey | QUYMORCKZPJFAC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.74 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|