C18H13Cl2NO5 — CID 7951334
2-(2,6-dichlorophenoxy)ethyl 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 7951334) has the molecular formula C18H13Cl2NO5 and a molecular weight of 394.21 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)ethyl 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | 2-(2,6-dichlorophenoxy)ethyl 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 7951334 |
| Molecular Formula | C18H13Cl2NO5 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 2-(2,6-dichlorophenoxy)ethyl 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)OCCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H13Cl2NO5/c19-13-6-3-7-14(20)16(13)26-9-8-25-15(22)10-21-17(23)11-4-1-2-5-12(11)18(21)24/h1-7H,8-10H2 |
| InChIKey | RDBBYWWGTZSXNV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|