C30H18N2O8 — CID 5194640
[5-[2-(1,3-dioxoisoindol-2-yl)acetyl]oxynaphthalen-1-yl] 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 5194640) has the molecular formula C30H18N2O8 and a molecular weight of 534.48 g/mol. Its IUPAC name is [5-[2-(1,3-dioxoisoindol-2-yl)acetyl]oxynaphthalen-1-yl] 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [5-[2-(1,3-dioxoisoindol-2-yl)acetyl]oxynaphthalen-1-yl] 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 5194640 |
| Molecular Formula | C30H18N2O8 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | [5-[2-(1,3-dioxoisoindol-2-yl)acetyl]oxynaphthalen-1-yl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Oc1cccc2c(OC(=O)CN3C(=O)c4ccccc4C3=O)cccc12 |
| InChI | InChI=1S/C30H18N2O8/c33-25(15-31-27(35)19-7-1-2-8-20(19)28(31)36)39-23-13-5-12-18-17(23)11-6-14-24(18)40-26(34)16-32-29(37)21-9-3-4-10-22(21)30(32)38/h1-14H,15-16H2 |
| InChIKey | UJPIUCHYPBIDHX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|