C16H21NO4Sn — CID 16684771
triethylstannyl 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 16684771) has the molecular formula C16H21NO4Sn and a molecular weight of 410.06 g/mol. Its IUPAC name is triethylstannyl 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | triethylstannyl 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 16684771 |
| Molecular Formula | C16H21NO4Sn |
| Molecular Weight | 410.06 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | triethylstannyl 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | CC[Sn](CC)(CC)OC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C10H7NO4.3C2H5.Sn/c12-8(13)5-11-9(14)6-3-1-2-4-7(6)10(11)15;3*1-2;/h1-4H,5H2,(H,12,13);3*1H2,2H3;/q;;;;+1/p-1 |
| InChIKey | RJBADMPNNGSGOY-UHFFFAOYSA-M |
| XLogP | 2.83 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.06 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|