C25H27NO7 — CID 54247570
2-[4-(2-methyloxirane-2-carbonyl)phenoxy]ethyl 2-(1,3-dioxoisoindol-2-yl)acetate;propane (PubChem CID 54247570) has the molecular formula C25H27NO7 and a molecular weight of 453.49 g/mol. Its IUPAC name is 2-[4-(2-methyloxirane-2-carbonyl)phenoxy]ethyl 2-(1,3-dioxoisoindol-2-yl)acetate;propane.
| Compound Name | 2-[4-(2-methyloxirane-2-carbonyl)phenoxy]ethyl 2-(1,3-dioxoisoindol-2-yl)acetate;propane |
|---|---|
| PubChem CID | 54247570 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-[4-(2-methyloxirane-2-carbonyl)phenoxy]ethyl 2-(1,3-dioxoisoindol-2-yl)acetate;propane |
| SMILES | CC1(C(=O)c2ccc(OCCOC(=O)CN3C(=O)c4ccccc4C3=O)cc2)CO1.CCC |
| InChI | InChI=1S/C22H19NO7.C3H8/c1-22(13-30-22)19(25)14-6-8-15(9-7-14)28-10-11-29-18(24)12-23-20(26)16-4-2-3-5-17(16)21(23)27;1-3-2/h2-9H,10-13H2,1H3;3H2,1-2H3 |
| InChIKey | QUIYVBGCYNRKDX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|